CAS 916176-51-7

1H-Pyrrolo[2,3-b]pyridine, 5-chloro-, 7-oxide

Description:

1H-Pyrrolo[2,3-b]pyridine, 5-chloro-, 7-oxide, identified by its CAS number 916176-51-7, is a heterocyclic organic compound characterized by a fused bicyclic structure that includes both pyrrole and pyridine rings. This compound features a chlorine substituent at the 5-position and an oxide group at the 7-position, which can influence its chemical reactivity and biological activity. Typically, such compounds exhibit properties that may include moderate to high solubility in polar solvents, and they may participate in various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, due to the presence of electron-rich and electron-deficient sites within the structure. The presence of the chlorine atom can enhance lipophilicity and may also affect the compound's pharmacological properties, making it of interest in medicinal chemistry. Additionally, the compound's unique structure may contribute to its potential applications in drug development, particularly in targeting specific biological pathways or receptors.

Formula: C₇H₅ClN₂O

InChI: InChI=1S/C7H5ClN2O/c8-6-3-5-1-2-9-7(5)10(11)4-6/h1-4,9H

InChI key: InChIKey=PHHWDHWGKYFFJW-UHFFFAOYSA-N

SMILES: O=N1=C2C(=CC(Cl)=C1)C=CN2

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-, 7-oxide

1H-pyrrolo[2,3-b]pyridine, 5-chloro-, 7-oxide

CAS: 916176-51-7

Formula: C₇H₅ClN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 168.5804

Ref: IN-DA00H01Y

5-Chloro-1H-pyrrolo[2,3-b]pyridine 7-oxide

CAS: 916176-51-7

5-Chloro-1H-pyrrolo[2,3-b]pyridine 7-oxide

Purity: 95%

Molecular weight: 168.58g/mol

Ref: 54-OR1053025