CAS 916176-69-7

(2S)-2-Amino-N-(2,2,2-trifluoroethyl)propanamide hydrochloride

Description:

(2S)-2-Amino-N-(2,2,2-trifluoroethyl)propanamide hydrochloride is a chemical compound characterized by its specific stereochemistry and functional groups. It features an amino group (-NH2) and an amide group (-C(=O)NH-) attached to a propanamide backbone, which contributes to its potential as a bioactive molecule. The presence of the trifluoroethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including drug formulation. The compound's stereochemistry, indicated by the (2S) designation, suggests that it has a specific three-dimensional arrangement that can significantly affect its interaction with biological targets. Overall, this compound's unique structural features may contribute to its potential utility in medicinal chemistry and related fields.

Formula: C₅H₁₀ClF₃N₂O

InChI: InChI=1/C5H9F3N2O.ClH/c1-3(9)4(11)10-2-5(6,7)8;/h3H,2,9H2,1H3,(H,10,11);1H/t3-;/m0./s1

SMILES: C[C@@H](C(=NCC(F)(F)F)O)N.Cl

Synonyms:

• (S)-2-amino-N-(2,2,2-trifluoroethyl)propanamide hydrochloride