CAS 91619-30-6

1-[(3-nitrophenyl)sulfonyl]pyrrolidine

Description:

1-[(3-Nitrophenyl)sulfonyl]pyrrolidine is an organic compound characterized by the presence of a pyrrolidine ring, which is a five-membered saturated nitrogen-containing heterocycle. The compound features a sulfonyl group attached to a 3-nitrophenyl moiety, indicating that it has both electron-withdrawing and electron-donating characteristics due to the nitro group and the sulfonyl group, respectively. This structural arrangement contributes to its potential reactivity and solubility in various solvents. The presence of the nitro group can enhance the compound's polarity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the sulfonyl group can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Overall, 1-[(3-nitrophenyl)sulfonyl]pyrrolidine is a compound that may exhibit unique properties and reactivity patterns, making it valuable for research and potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₀H₁₂N₂O₄S

InChI: InChI=1/C10H12N2O4S/c13-12(14)9-4-3-5-10(8-9)17(15,16)11-6-1-2-7-11/h3-5,8H,1-2,6-7H2

SMILES: C1CCN(C1)S(=O)(=O)c1cccc(c1)N(=O)=O

Synonyms:

• Pyrrolidine, 1-[(3-Nitrophenyl)Sulfonyl]-

1-((3-Nitrophenyl)sulfonyl)pyrrolidine

CAS: 91619-30-6

Formula: C₁₀H₁₂N₂O₄S

Molecular weight: 256.2783

Ref: IN-DA003CXO