CAS 91619-31-7

1-[(3-Nitrophenyl)sulfonyl]piperidine

Description:

1-[(3-Nitrophenyl)sulfonyl]piperidine is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The compound features a sulfonyl group attached to a 3-nitrophenyl moiety, contributing to its unique chemical properties. The presence of the nitro group (-NO2) on the phenyl ring enhances its electrophilic character, making it potentially reactive in various chemical reactions. This compound is typically used in organic synthesis and medicinal chemistry, often as an intermediate in the development of pharmaceuticals. Its sulfonyl group can participate in nucleophilic substitution reactions, while the piperidine ring may influence the compound's biological activity and solubility. Additionally, the compound's structure suggests potential applications in the design of inhibitors or modulators in biochemical pathways. Safety and handling precautions should be observed due to the presence of the nitro group, which can pose health risks. Overall, 1-[(3-Nitrophenyl)sulfonyl]piperidine is a versatile compound with significant implications in chemical research and development.

Formula: C₁₁H₁₄N₂O₄S

InChI: InChI=1S/C11H14N2O4S/c14-13(15)10-5-4-6-11(9-10)18(16,17)12-7-2-1-3-8-12/h4-6,9H,1-3,7-8H2

InChI key: InChIKey=BZBNTCYTNHCSJU-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(N(=O)=O)=CC=C1)N2CCCCC2

Synonyms:

• Piperidine, 1-[(m-nitrophenyl)sulfonyl]-
• 1-(3-Nitrobenzenesulfonyl)piperidine
• NSC 175845
• 1-[(3-Nitrophenyl)sulfonyl]piperidine
• Piperidine, 1-[(3-nitrophenyl)sulfonyl]-

1-((3-Nitrophenyl)sulfonyl)piperidine

CAS: 91619-31-7

Formula: C₁₁H₁₄N₂O₄S

Molecular weight: 270.3049

Ref: IN-DA003CS0