CAS 91619-38-4

3-(pyrrolidin-1-ylsulfonyl)aniline

Description:

3-(Pyrrolidin-1-ylsulfonyl)aniline, identified by its CAS number 91619-38-4, is an organic compound characterized by the presence of both an aniline and a pyrrolidine moiety linked through a sulfonyl group. This compound typically exhibits properties associated with sulfonamides, including potential solubility in polar solvents due to the sulfonyl functional group. The presence of the pyrrolidine ring contributes to its structural rigidity and may influence its biological activity, making it of interest in medicinal chemistry. The aniline portion of the molecule can participate in various chemical reactions, including electrophilic aromatic substitution, due to the electron-donating nature of the amino group. Additionally, the compound may exhibit specific interactions with biological targets, which could be relevant for pharmaceutical applications. Overall, 3-(pyrrolidin-1-ylsulfonyl)aniline is a compound of interest for research in drug development and synthetic chemistry, with potential implications in various fields, including pharmacology and materials science.

Formula: C₁₀H₁₄N₂O₂S

InChI: InChI=1/C10H14N2O2S/c11-9-4-3-5-10(8-9)15(13,14)12-6-1-2-7-12/h3-5,8H,1-2,6-7,11H2

SMILES: C1CCN(C1)S(=O)(=O)c1cccc(c1)N

Synonyms:

• 3-(Pyrrolidine-1-sulfonyl)-phenylamine
• Aniline, 3-(pyrrolidine-1-sulfonyl)-
• Benzenamine, 3-(1-Pyrrolidinylsulfonyl)-

3-(Pyrrolidin-1-ylsulphonyl)aniline

CAS: 91619-38-4

3-(Pyrrolidin-1-ylsulphonyl)aniline

Formula: C₁₀H₁₄N₂O₂S

Purity: 97%

Color and Shape: yellow solid

Molecular weight: 226.30g/mol

Ref: 54-OR14250