CAS 916211-28-4

Bicyclo[2.2.1]heptane-1-carboxylic acid, 4-(aminomethyl)-, methyl ester, hydrochloride (1:1)

Description:

Bicyclo[2.2.1]heptane-1-carboxylic acid, 4-(aminomethyl)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which consists of a seven-membered ring system. The presence of a carboxylic acid group and an amine substituent indicates potential for both acidic and basic properties, making it a zwitterionic compound in certain conditions. The methyl ester functional group suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid. The hydrochloride form indicates that the compound is a salt, which typically enhances its solubility in water and may influence its pharmacological properties. This compound may exhibit biological activity due to the presence of the amine group, which can participate in hydrogen bonding and interact with biological targets. Its unique bicyclic structure may also contribute to specific conformational properties, affecting its reactivity and interactions. Overall, this compound is of interest in medicinal chemistry and may have applications in drug development or as a biochemical probe.

Formula: C₁₀H₁₇NO₂·ClH

InChI: InChI=1S/C10H17NO2.ClH/c1-13-8(12)10-4-2-9(6-10,7-11)3-5-10;/h2-7,11H2,1H3;1H

InChI key: InChIKey=UIZOYCDWLNJUSD-UHFFFAOYSA-N

SMILES: C(OC)(=O)C12CC(CN)(CC1)CC2.Cl

Synonyms:

• Bicyclo[2.2.1]heptane-1-carboxylic acid, 4-(aminomethyl)-, methyl ester, hydrochloride (1:1)

Bicyclo[2.2.1]heptane-1-carboxylic acid, 4-(aminomethyl)-, methyl ester, hydrochloride (1:1)

CAS: 916211-28-4

Formula: C₁₀H₁₈ClNO₂

Purity: 97%

Molecular weight: 219.7084

Ref: IN-DA01RU2G