CAS 916211-41-1
:[2-(trifluoromethyl)-4-pyridyl]methanamine dihydrochloride
Description:
[2-(Trifluoromethyl)-4-pyridyl]methanamine dihydrochloride is a chemical compound characterized by its pyridine ring, which is substituted with a trifluoromethyl group and a methanamine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the dihydrochloride salt form, which enhances its solubility and stability. The trifluoromethyl group contributes to its unique electronic properties, potentially influencing its reactivity and interactions in biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its molecular structure suggests potential applications in medicinal chemistry, where modifications to the pyridine ring or amine group could lead to derivatives with varied biological activities. As with many chemical substances, handling should be conducted with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C7H9Cl2F3N2
InChI:InChI=1/C7H7F3N2.2ClH/c8-7(9,10)6-3-5(4-11)1-2-12-6;;/h1-3H,4,11H2;2*1H
SMILES:c1cnc(cc1CN)C(F)(F)F.Cl.Cl
Synonyms:- (2-(Trifluoromethyl)Pyridin-4-Yl)Methanamine Dihydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.