CAS 916213-94-0

Methyl 3-chloro-7-methylpyrazolo[1,5-a]pyrimidine-5-carboxylate

Description:

Methyl 3-chloro-7-methylpyrazolo[1,5-a]pyrimidine-5-carboxylate is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both a pyrazole and a pyrimidine ring. This compound features a methyl group and a chloro substituent, contributing to its reactivity and potential biological activity. The presence of the carboxylate functional group indicates that it can participate in various chemical reactions, such as esterification or nucleophilic substitution. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heterocyclic rings that are often associated with bioactive compounds. The compound's CAS number, 916213-94-0, allows for easy identification and retrieval of information in chemical databases. Overall, Methyl 3-chloro-7-methylpyrazolo[1,5-a]pyrimidine-5-carboxylate is of interest for its synthetic versatility and potential therapeutic applications, although specific biological activities would require further investigation through experimental studies.

Formula: C₉H₈ClN₃O₂

InChI: InChI=1S/C9H8ClN3O2/c1-5-3-7(9(14)15-2)12-8-6(10)4-11-13(5)8/h3-4H,1-2H3

InChI key: InChIKey=RDTBORAXNZLLDG-UHFFFAOYSA-N

SMILES: ClC1=C2N(C(C)=CC(C(OC)=O)=N2)N=C1

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-5-carboxylic acid, 3-chloro-7-methyl-, methyl ester
• 3-Chloro-7-methylpyrazolo[1,5-a]pyrimidine-5-carboxylic acid methyl ester
• Methyl 3-chloro-7-methylpyrazolo[1,5-a]pyrimidine-5-carboxylate