CAS 916214-31-8
:1-Pyrrolidinecarboxylic acid, 3-(aminomethyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1), (3R)-
Description:
1-Pyrrolidinecarboxylic acid, 3-(aminomethyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1), (3R)-, is a chemical compound characterized by its pyrrolidine ring structure, which contributes to its cyclic nature and potential biological activity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions, while the ester functionality suggests it may undergo hydrolysis under certain conditions. The compound's hydrochloride form enhances its solubility in water, making it more bioavailable for pharmaceutical applications. The (3R)- configuration denotes its specific stereochemistry, which is crucial for its interaction with biological systems, potentially influencing its pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or metabolic pathways. Its unique combination of functional groups and stereochemistry could lead to specific interactions with receptors or enzymes, making it a candidate for further research in therapeutic applications.
Formula:C10H20N2O2·ClH
InChI:InChI=1S/C10H20N2O2.ClH/c1-10(2,3)14-9(13)12-5-4-8(6-11)7-12;/h8H,4-7,11H2,1-3H3;1H/t8-;/m1./s1
InChI key:InChIKey=QKIJZDUDCUIGGM-DDWIOCJRSA-N
SMILES:C(OC(C)(C)C)(=O)N1C[C@@H](CN)CC1.Cl
Synonyms:- (R)-1-Boc-3-Aminomethylpyrrolidine hydrochloride
- 1-Pyrrolidinecarboxylic acid, 3-(aminomethyl)-, 1,1-dimethylethyl ester, hydrochloride (1:1), (3R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
