
CAS 916256-66-1
:6-Bromo-2-(2-thienyl)pyrazolo[1,5-a]pyrimidine
Description:
6-Bromo-2-(2-thienyl)pyrazolo[1,5-a]pyrimidine is a heterocyclic compound characterized by its unique structural features, which include a pyrazolo-pyrimidine core and a bromine atom at the 6-position. This compound contains a thienyl group at the 2-position, contributing to its aromatic properties and potential reactivity. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including cross-coupling and substitution reactions. The thienyl moiety adds to the compound's electronic properties, potentially influencing its interactions with biological targets. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as solubility, stability, and reactivity, can vary based on environmental conditions and the presence of other functional groups. Overall, 6-Bromo-2-(2-thienyl)pyrazolo[1,5-a]pyrimidine represents a versatile scaffold for further chemical exploration and potential applications in pharmaceuticals.
Formula:C10H6BrN3S
InChI:InChI=1S/C10H6BrN3S/c11-7-5-12-10-4-8(13-14(10)6-7)9-2-1-3-15-9/h1-6H
InChI key:InChIKey=NTRPKQSOTZKVIZ-UHFFFAOYSA-N
SMILES:BrC1=CN2N=C(C=C2N=C1)C3=CC=CS3
Synonyms:- Pyrazolo[1,5-a]pyrimidine, 6-bromo-2-(2-thienyl)-
- 6-Bromo-2-(2-thienyl)pyrazolo[1,5-a]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.