CAS 916303-91-8

6-(Aminomethyl)-4-methyl-2H-1,4-benzoxazin-3(4H)-one

Description:

6-(Aminomethyl)-4-methyl-2H-1,4-benzoxazin-3(4H)-one, with the CAS number 916303-91-8, is a chemical compound characterized by its unique benzoxazine structure, which incorporates both an amine and a carbonyl functional group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The methyl group contributes to its hydrophobic character, influencing its overall solubility and reactivity. The benzoxazine moiety is known for its thermal stability and potential applications in polymer chemistry, particularly in the development of thermosetting resins. Additionally, the presence of the amino group may impart biological activity, making it of interest in medicinal chemistry. Its synthesis often involves multi-step organic reactions, and it may serve as a precursor or intermediate in the synthesis of more complex organic molecules. Overall, this compound's structural features suggest a range of potential applications in materials science and pharmaceuticals.

Formula: C₁₀H₁₂N₂O₂

InChI: InChI=1S/C10H12N2O2/c1-12-8-4-7(5-11)2-3-9(8)14-6-10(12)13/h2-4H,5-6,11H2,1H3

InChI key: InChIKey=FSQKKHDRRCAMMU-UHFFFAOYSA-N

SMILES: CN1C=2C(=CC=C(CN)C2)OCC1=O

Synonyms:

• 2H-1,4-Benzoxazin-3(4H)-one, 6-(aminomethyl)-4-methyl-
• 6-(Aminomethyl)-4-methyl-2H-1,4-benzoxazin-3(4H)-one