CAS 916326-10-8
:ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate
Description:
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)nicotinate is a chemical compound characterized by its unique structure, which includes a nicotinate moiety and a boron-containing dioxaborolane group. This compound features a boron atom that is part of a dioxaborolane ring, contributing to its potential reactivity and utility in organic synthesis, particularly in the context of boron chemistry. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various applications in medicinal chemistry and material science. The compound may exhibit interesting biological properties due to the nicotinate component, which is related to nicotinic acid, a precursor to important coenzymes. Additionally, the sterically hindered boron group can influence the compound's reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Overall, this compound represents a versatile building block in synthetic organic chemistry, with potential applications in drug development and other fields.
Formula:C14H20BNO4
InChI:InChI=1S/C14H20BNO4/c1-6-18-12(17)10-7-11(9-16-8-10)15-19-13(2,3)14(4,5)20-15/h7-9H,6H2,1-5H3
SMILES:CCOC(=O)c1cc(cnc1)B1OC(C)(C)C(C)(C)O1
Synonyms:- 5-(Ethoxycarbonyl)pyridine-3-boronic acid pinacol ester
- 3-(Ethoxycarbonyl)Pyridine-5-Boronic Acid Pinacol Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(Ethoxycarbonyl)pyridine-5-boronic acid pinacol ester
CAS:Formula:C14H20BNO4Purity:96%Color and Shape:SolidMolecular weight:277.12393-(Ethoxycarbonyl)pyridine-5-boronic acid, pinacol ester
CAS:<p>3-(Ethoxycarbonyl)pyridine-5-boronic acid, pinacol ester</p>Purity:≥95%Molecular weight:277.12g/mol3-(Ethoxycarbonyl)pyridine-5-boronic acid pinacol ester
CAS:Formula:C14H20BNO4Purity:96%Color and Shape:SolidMolecular weight:277.133-(Ethoxycarbonyl)pyridine-5-boronic acid pinacol ester
CAS:<p>3-(Ethoxycarbonyl)pyridine-5-boronic acid pinacol ester is an organic compound that is used in organic synthesis. It is a pinacol ester derivative of 3-(ethoxycarbonyl)pyridine-5-boronic acid. The compound can be isolated from the reaction mixture after coupling with a boronate reagent, which makes it trackable. This pinacol ester is an intermediate for the Suzuki coupling reaction, which allows for the synthesis of various ring systems in organic chemistry. Pinacol esters are also used to produce polyesters and polycarbonates.</p>Formula:C14H20BNO4Purity:Min. 95%Molecular weight:277.12 g/mol




