CAS 916334-62-8

2-(1-Benzyl-1H-pyrrol-2-yl)-4,6-bis(2,4-dihydroxyphenyl)-1,3,5-triazine

Description:

2-(1-Benzyl-1H-pyrrol-2-yl)-4,6-bis(2,4-dihydroxyphenyl)-1,3,5-triazine is a synthetic organic compound characterized by its complex molecular structure, which includes a triazine core substituted with various functional groups. This compound features a benzyl group and a pyrrole moiety, contributing to its potential biological activity. The presence of multiple hydroxyl groups on the phenyl rings enhances its solubility in polar solvents and may impart antioxidant properties. The triazine framework is known for its stability and ability to participate in various chemical reactions, making it a subject of interest in medicinal chemistry and materials science. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with anti-cancer or anti-inflammatory properties. Additionally, the compound's interactions with biological systems could be explored for therapeutic uses, although specific biological activities would require further investigation through experimental studies. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function in organic chemistry.

Formula: C₂₆H₂₀N₄O₄

InChI: InChI=1/C26H20N4O4/c31-17-8-10-19(22(33)13-17)24-27-25(20-11-9-18(32)14-23(20)34)29-26(28-24)21-7-4-12-30(21)15-16-5-2-1-3-6-16/h1-14,31-34H,15H2

SMILES: c1ccc(cc1)Cn1cccc1c1nc(c2ccc(cc2O)O)nc(c2ccc(cc2O)O)n1