CAS 91634-12-7

2-ethenylquinazolin-4(1H)-one

Description:

2-Ethenylquinazolin-4(1H)-one, with the CAS number 91634-12-7, is a heterocyclic organic compound characterized by its quinazolinone structure, which features a fused bicyclic system containing both a benzene and a pyrimidine ring. This compound typically exhibits a range of chemical properties, including the ability to participate in various chemical reactions due to the presence of the ethenyl group, which can engage in electrophilic addition or polymerization. The quinazolinone moiety is known for its biological activity, often serving as a scaffold in medicinal chemistry for the development of pharmaceuticals. The compound may display fluorescence properties and can be soluble in organic solvents, depending on its specific substituents and the conditions. Its potential applications include use in drug development, particularly in targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or inhaled.

Formula: C₁₀H₈N₂O

InChI: InChI=1/C10H8N2O/c1-2-9-11-8-6-4-3-5-7(8)10(13)12-9/h2-6H,1H2,(H,11,12,13)

SMILES: C=Cc1nc2ccccc2c(n1)O

STIMA-1

CAS: 91634-12-7

STIMA-1 (2-Vinylquinazolin-4-ol), an active compound, can restore the activity of p63.

Formula: C₁₀H₈N₂O

Purity: 99.37%

Color and Shape: Solid

Molecular weight: 172.18

Ref: TM-T67858

2-VINYL-4-QUINAZOLINOL

CAS: 91634-12-7

Formula: C₁₀H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 172.1833

Ref: IN-DA00GRI3

STIMA-1

CAS: 91634-12-7

STIMA-1

Purity: ≥98%

Molecular weight: 172.18g/mol

Ref: 54-BUP06523

2-ethenyl-1,4-dihydroquinazolin-4-one

CAS: 91634-12-7

Purity: 98%

Molecular weight: 172.19

Ref: 10-F610725

2-Ethenyl-3,4-dihydroquinazolin-4-one

Controlled Product

CAS: 91634-12-7

Stability Light Sensitive
Applications 2-ethenyl-3,4-dihydroquinazolin-4-one (cas# 91634-12-7) is a useful research chemical.

Formula: C₁₀H₈N₂O

Color and Shape: Neat

Molecular weight: 172.18

Ref: TR-B126350

2-Vinyl-4-quinazolinol

CAS: 91634-12-7

Versatile small molecule scaffold

Formula: C₁₀H₈N₂O

Purity: Min. 95%

Molecular weight: 172.19 g/mol

Ref: 3D-RDA63412