CAS 916343-43-6

6-(Dimethylamino)-5-methyl-3-pyridinecarboxylic acid

Description:

6-(Dimethylamino)-5-methyl-3-pyridinecarboxylic acid, identified by its CAS number 916343-43-6, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a dimethylamino group, which enhances its basicity and potential for forming hydrogen bonds, and a carboxylic acid functional group, contributing to its acidity and reactivity. The presence of the methyl group at the 5-position of the pyridine ring influences its steric and electronic properties, potentially affecting its solubility and interaction with biological systems. This compound may exhibit various biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including esterification and amidation, and may serve as a building block in the synthesis of more complex molecules. Overall, its unique combination of functional groups and structural features makes it a compound of interest in both synthetic and medicinal chemistry.

Formula: C₉H₁₂N₂O₂

InChI: InChI=1S/C9H12N2O2/c1-6-4-7(9(12)13)5-10-8(6)11(2)3/h4-5H,1-3H3,(H,12,13)

InChI key: InChIKey=JBYKXSRLUWTGHO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C)C(N(C)C)=NC1

Synonyms:

• 3-Pyridinecarboxylic acid, 6-(dimethylamino)-5-methyl-
• 6-(Dimethylamino)-5-methyl-3-pyridinecarboxylic acid
• 6-Dimethylamino-5-methyl-nicotinic acid