CAS 91635-05-1
:oxo(2-oxo-2H-chromen-3-yl)acetaldehyde
Description:
Oxo(2-oxo-2H-chromen-3-yl)acetaldehyde, also known by its CAS number 91635-05-1, is a chemical compound that belongs to the class of chromenones, which are derivatives of coumarin. This substance features a chromen-3-one structure, characterized by a fused benzene and pyrone ring system, along with an aldehyde functional group. The presence of the oxo group indicates that it contains a carbonyl (C=O) functionality, which contributes to its reactivity and potential applications in organic synthesis. The compound is typically a yellow to brown solid, exhibiting moderate solubility in organic solvents. Its unique structure allows for various chemical transformations, making it of interest in medicinal chemistry and material science. Additionally, compounds with similar structures have been studied for their biological activities, including anti-inflammatory and antioxidant properties. However, specific biological data and applications may vary, and further research is often necessary to fully understand the potential uses of this compound in various fields.
Formula:C11H6O4
InChI:InChI=1/C11H6O4/c12-6-9(13)8-5-7-3-1-2-4-10(7)15-11(8)14/h1-6H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Coumarin, 3-glyoxyloyl-
CAS:Coumarin derivative, 3-glyoxyloyl-, may treat diseases, altering its core could yield new cancer therapies.Formula:C11H6O4Color and Shape:SolidMolecular weight:202.16
