CymitQuimica logo

CAS 91636-02-1

:

2-methyl-2-[(2-methylpentan-2-yl)disulfanyl]pentane

Description:
2-Methyl-2-[(2-methylpentan-2-yl)disulfanyl]pentane is an organosulfur compound characterized by the presence of a disulfide functional group, which consists of two sulfur atoms bonded together, attached to a branched alkane structure. This compound features a pentane backbone with methyl groups that contribute to its branched nature, enhancing its steric hindrance and potentially influencing its physical properties. The presence of sulfur atoms in the structure suggests that it may exhibit unique reactivity, particularly in redox reactions or as a ligand in coordination chemistry. The compound's molecular structure may lead to specific solubility characteristics, likely being more soluble in organic solvents than in water due to its hydrophobic alkane portions. Additionally, the branched structure can affect its boiling and melting points compared to straight-chain isomers. Overall, 2-methyl-2-[(2-methylpentan-2-yl)disulfanyl]pentane is a complex molecule that may have applications in organic synthesis or materials science, although specific applications would depend on further research into its properties and reactivity.
Formula:C12H26S2
InChI:InChI=1/C12H26S2/c1-7-9-11(3,4)13-14-12(5,6)10-8-2/h7-10H2,1-6H3
SMILES:CCCC(C)(C)SSC(C)(C)CCC
Synonyms:
  • 1,1-Dimethylbutyl disulfide
  • Bis(1,1-dimethylbutyl) disulfide
  • Bis(2-Methylpentan-2-Yl) Disulfide
  • Disulfide, Bis(1,1-Dimethylbutyl)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.