
CAS 91640-16-3
:2-Benzothiazolepentanol
Description:
2-Benzothiazolepentanol, identified by its CAS number 91640-16-3, is a chemical compound that features a benzothiazole moiety, which is a bicyclic structure consisting of a benzene ring fused to a thiazole ring. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in various fields, including pharmaceuticals and materials science. The presence of the hydroxyl (-OH) group in its structure suggests that it may exhibit properties such as solubility in polar solvents and the ability to participate in hydrogen bonding. Additionally, benzothiazole derivatives are known for their biological activity, which may include antimicrobial or antifungal properties. The specific reactivity and stability of 2-benzothiazolepentanol can be influenced by its functional groups and the overall molecular structure, making it a subject of interest for further research and development in chemical synthesis and application.
Formula:C12H15NOS
InChI:InChI=1S/C12H15NOS/c14-9-5-1-2-8-12-13-10-6-3-4-7-11(10)15-12/h3-4,6-7,14H,1-2,5,8-9H2
InChI key:InChIKey=DSEWWHZFOSULRI-UHFFFAOYSA-N
SMILES:C(CCCCO)C1=NC=2C(S1)=CC=CC2
Synonyms:- 2-Benzothiazolepentanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.