CAS 916420-21-8
:Benzene, 2-fluoro-1-iodo-3-methyl-
Description:
Benzene, 2-fluoro-1-iodo-3-methyl- is an aromatic organic compound characterized by a benzene ring substituted with a fluorine atom at the second position, an iodine atom at the first position, and a methyl group at the third position. This compound belongs to the class of halogenated aromatic hydrocarbons, which are known for their diverse chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of both fluorine and iodine introduces unique properties, such as increased electronegativity and potential for nucleophilic substitution reactions. The methyl group contributes to the compound's hydrophobic character, influencing its solubility and interaction with biological systems. Additionally, the specific arrangement of substituents can affect the compound's stability, reactivity, and overall chemical behavior. As with many halogenated compounds, safety considerations are important due to potential toxicity and environmental impact, necessitating careful handling and disposal practices.
Formula:C7H6FI
InChI:InChI=1/C7H6FI/c1-5-3-2-4-6(9)7(5)8/h2-4H,1H3
SMILES:Cc1cccc(c1F)I
Synonyms:- 2-Fluor-1-iod-3-methylbenzol
- 2-Fluoro-1-iodo-3-methylbenzene
- 2-Fluoro-3-iodotoluene
- benzene, 2-fluoro-1-iodo-3-methyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Fluoro-1-Iodo-3-Methylbenzene
CAS:2-Fluoro-1-Iodo-3-MethylbenzenePurity:98%Molecular weight:236.02g/mol2-Fluoro-3-iodotoluene
CAS:2-Fluoro-3-iodotoluene is a useful building block which has found use as a versatile intermediate in organic synthesis, as a reaction component in research chemical reactions, and as a speciality chemical. It is also used as a reagent for the fluorination of alcohols. This compound can be used as an effective building block in the synthesis of high-quality complex compounds with a range of properties. 2-Fluoro-3-iodotoluene is classified as an extremely hazardous substance and should be handled with care.Formula:C7H6FIPurity:Min. 95%Color and Shape:Yellow PowderMolecular weight:236.03 g/mol2-Fluoro-1-iodo-3-methylbenzene
CAS:Formula:C7H6FIPurity:95%+Color and Shape:LiquidMolecular weight:236.028



