CAS 916420-25-2
:9H-Fluoren-9-ylmethyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate
Description:
9H-Fluoren-9-ylmethyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate, identified by its CAS number 916420-25-2, is a chemical compound characterized by its complex structure, which includes a fluorenylmethyl group and a pyrido-pyrimidine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the carboxylate and chloro substituents. It may demonstrate biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the pyrimidine ring suggests potential interactions with biological targets, such as enzymes or receptors. Additionally, the compound's stability and reactivity can be influenced by environmental factors like pH and temperature. Overall, this substance represents a unique combination of structural features that may confer specific chemical and biological properties, warranting further investigation in research and application contexts.
Formula:C22H18ClN3O2
InChI:InChI=1S/C22H18ClN3O2/c23-21-18-11-26(10-9-20(18)24-13-25-21)22(27)28-12-19-16-7-3-1-5-14(16)15-6-2-4-8-17(15)19/h1-8,13,19H,9-12H2
InChI key:InChIKey=LKMQJBUAKFFRHD-UHFFFAOYSA-N
SMILES:C(OC(=O)N1CC=2C(CC1)=NC=NC2Cl)C3C=4C(C=5C3=CC=CC5)=CC=CC4
Synonyms:- Pyrido[4,3-d]pyrimidine-6(5H)-carboxylic acid, 4-chloro-7,8-dihydro-, 9H-fluoren-9-ylmethyl ester
- 9H-Fluoren-9-ylmethyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(9H-Fluoren-9-yl)methyl 4-chloro-7,8-dihydropyrido[4,3-d]pyrimidine-6(5H)-carboxylate
CAS:Formula:C22H18ClN3O2Molecular weight:391.8502
