CAS 916423-50-2

3-(3-fluorophenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine

Description:

3-(3-fluorophenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyrazolo ring fused to a pyridine ring. The presence of a fluorophenyl group enhances its lipophilicity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of nitrogen atoms in the pyrazolo and pyridine rings. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The fluorine substituent can also play a crucial role in modulating the compound's pharmacokinetic properties, such as metabolic stability and receptor binding affinity. Overall, this compound represents a class of molecules that may exhibit interesting pharmacological profiles, warranting further investigation in drug discovery and development contexts.

Formula: C₁₂H₁₂FN₃

InChI: InChI=1/C12H12FN3/c13-9-3-1-2-8(6-9)12-10-7-14-5-4-11(10)15-16-12/h1-3,6,14H,4-5,7H2,(H,15,16)

SMILES: c1cc(cc(c1)F)c1c2CNCCc2[nH]n1

3-(3-Fluorophenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine

CAS: 916423-50-2

Purity: 95.0%

Molecular weight: 217.2469940185547

Ref: 10-F046438

3-(3-Fluorophenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine

CAS: 916423-50-2

3-(3-Fluorophenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine

Purity: 95%

Molecular weight: 217.24g/mol

Ref: 54-PC409515