CAS 916423-54-6

3-(2-bromophenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine

Description:

3-(2-Bromophenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyrazolo and pyridine moiety. The presence of the bromophenyl group introduces significant polarity and potential for various chemical interactions, making it a compound of interest in medicinal chemistry. This substance typically exhibits moderate to high lipophilicity due to its aromatic and aliphatic components, which can influence its bioavailability and pharmacokinetic properties. The tetrahydro configuration suggests that it is a saturated derivative, potentially affecting its reactivity and stability. Additionally, the compound may exhibit biological activity, which could be explored for therapeutic applications, particularly in the fields of neuropharmacology or oncology. Its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. Overall, this compound represents a unique scaffold that could be valuable in drug discovery and development.

Formula: C₁₂H₁₂BrN₃

InChI: InChI=1/C12H12BrN3/c13-10-4-2-1-3-8(10)12-9-7-14-6-5-11(9)15-16-12/h1-4,14H,5-7H2,(H,15,16)

InChI key: InChIKey=CRFJNEPWUKQMPI-UHFFFAOYSA-N

SMILES: c1ccc(c(c1)c1c2CNCCc2[nH]n1)Br

3-(2-Bromophenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine

CAS: 916423-54-6

Purity: 95.0%

Molecular weight: 278.15301513671875

Ref: 10-F046439

3-(2-Bromophenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine

CAS: 916423-54-6

3-(2-Bromophenyl)-4,5,6,7-tetrahydro-2H-pyrazolo[4,3-c]pyridine

Purity: 95%

Molecular weight: 278.15g/mol

Ref: 54-OR318107