CAS 91643-11-7

N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propan-2-amine

Description:

N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]propan-2-amine, with the CAS number 91643-11-7, is a chemical compound characterized by its unique structure that includes an oxadiazole ring and an amine functional group. The presence of the phenyl group contributes to its aromatic properties, while the oxadiazole moiety is known for its potential biological activity, including antimicrobial and anti-inflammatory effects. This compound is likely to exhibit moderate to high polarity due to the amine and oxadiazole functionalities, which can influence its solubility in various solvents. Additionally, the presence of the propan-2-amine group suggests that it may participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. Its potential applications could span across pharmaceuticals and materials science, particularly in the development of new drugs or functional materials. However, specific safety and handling information should be consulted from reliable sources, as the biological effects and toxicity profiles of such compounds can vary significantly.

Formula: C₁₂H₁₅N₃O

InChI: InChI=1/C12H15N3O/c1-9(2)13-8-11-14-12(15-16-11)10-6-4-3-5-7-10/h3-7,9,13H,8H2,1-2H3

SMILES: CC(C)NCc1nc(c2ccccc2)no1

Synonyms:

• 1,2,4-oxadiazole-5-methanamine, N-(1-methylethyl)-3-phenyl-

N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-2-propanamine

CAS: 91643-11-7

Formula: C₁₂H₁₅N₃O

Molecular weight: 217.2670

Ref: IN-DA006F71

N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]-2-propanamine

CAS: 91643-11-7

Formula: C₁₂H₁₅N₃O

Purity: 95.0%

Molecular weight: 217.272

Ref: 10-F315569