CymitQuimica logo

CAS 916574-87-3

:

1-(benzenesulfonyl)-4-methoxy-pyrrolo[2,3-b]pyridine

Description:
1-(Benzenesulfonyl)-4-methoxy-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its unique structure, which includes a pyrrolo[2,3-b]pyridine core substituted with a benzenesulfonyl group and a methoxy group. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the sulfonyl group may impart sulfonamide-like characteristics, influencing its reactivity and potential biological activity. The methoxy group can affect the electronic properties of the molecule, potentially enhancing its lipophilicity and influencing interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with various biological pathways. As with many organic compounds, its specific characteristics, such as melting point, boiling point, and spectral properties, would need to be determined experimentally or sourced from reliable chemical databases for precise applications.
Formula:C14H12N2O3S
InChI:InChI=1/C14H12N2O3S/c1-19-13-7-9-15-14-12(13)8-10-16(14)20(17,18)11-5-3-2-4-6-11/h2-10H,1H3
SMILES:COc1ccnc2c1ccn2S(=O)(=O)c1ccccc1
Synonyms:
  • 4-Methoxy-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridin
  • 4-methoxy-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.