CAS 916574-88-4

2-Iodo-4-methoxy-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine

Description:

2-Iodo-4-methoxy-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a chemical compound characterized by its complex structure, which includes a pyrrolopyridine core substituted with an iodo group, a methoxy group, and a phenylsulfonyl moiety. The presence of the iodo substituent enhances its reactivity and potential for further chemical modifications, while the methoxy group can influence its solubility and electronic properties. The phenylsulfonyl group contributes to the compound's stability and may enhance its biological activity. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit unique pharmacological properties. Its molecular structure allows for interactions with various biological targets, making it a candidate for further investigation in therapeutic contexts. Additionally, the compound's synthesis and characterization involve standard organic chemistry techniques, and its properties can be explored through various analytical methods, including NMR and mass spectrometry.

Formula: C₁₄H₁₁IN₂O₃S

InChI: InChI=1S/C14H11IN2O3S/c1-20-12-7-8-16-14-11(12)9-13(15)17(14)21(18,19)10-5-3-2-4-6-10/h2-9H,1H3

InChI key: InChIKey=ATUPLTKOWVQTLX-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1C=2C(=C(OC)C=CN2)C=C1I)C3=CC=CC=C3

Synonyms:

• 1-Phenylsulfonyl-2-iodo-4-methoxy-7-azaindole
• 1H-Pyrrolo[2,3-b]pyridine, 2-iodo-4-methoxy-1-(phenylsulfonyl)-
• 1-(Benzenesulfonyl)-2-iodo-4-methoxypyrrolo[2,3-b]pyridine
• 2-Iodo-4-methoxy-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine
• 1-(Phenylsulphonyl)-2-iodo-4-methoxy-7-azaindole

2-Iodo-4-methoxy-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine

CAS: 916574-88-4

Formula: C₁₄H₁₁IN₂O₃S

Molecular weight: 414.2182

Ref: IN-DA00IGTR

2-Iodo-4-methoxy-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine

CAS: 916574-88-4

2-Iodo-4-methoxy-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine is a peptide that is used as a research tool in cell biology and pharmacology. It is an activator of ion channels and has been shown to inhibit the binding of ligands to receptors. 2-Iodo-4-methoxy-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine binds to the extracellular loop of the L type voltage gated calcium channel (CaV). This binding prevents CaV activation and prevents the influx of Ca2+ ions into cells.

Formula: C₁₄H₁₁IN₂O₃S

Purity: Min. 95%

Molecular weight: 414.22 g/mol

Ref: 3D-RLB57488