CAS 91658-79-6
:3-(2-aminophenyl)quinoxalin-2(1H)-one
Description:
3-(2-Aminophenyl)quinoxalin-2(1H)-one, identified by the CAS number 91658-79-6, is a heterocyclic organic compound characterized by its quinoxaline core structure, which is fused with an amino-substituted phenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the amino group can influence its reactivity and interactions, potentially allowing for hydrogen bonding and participation in various chemical reactions. Additionally, the quinoxaline moiety is known for its role in various biological activities, including antimicrobial and anticancer properties. The compound's molecular structure suggests it may engage in π-π stacking interactions due to its aromatic components, which can be relevant in drug design and development. Overall, 3-(2-aminophenyl)quinoxalin-2(1H)-one represents a valuable scaffold for further exploration in pharmaceutical applications.
Formula:C14H11N3O
InChI:InChI=1/C14H11N3O/c15-10-6-2-1-5-9(10)13-14(18)17-12-8-4-3-7-11(12)16-13/h1-8H,15H2,(H,17,18)
SMILES:c1ccc(c(c1)c1c(=O)[nH]c2ccccc2n1)N
Synonyms:- 2(1H)-Quinoxalinone, 3-(2-aminophenyl)-
- 2-Quinoxalinol, 3-(2-Aminophenyl)-
- 3-(2-Aminophenyl)Quinoxalin-2-Ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
