CAS 91659-08-4

2,4-difluoro-3-hydroxybenzoic acid

Description:

2,4-Difluoro-3-hydroxybenzoic acid is an aromatic compound characterized by the presence of two fluorine atoms and a hydroxyl group on a benzoic acid framework. The molecular structure features a benzene ring with a carboxylic acid (-COOH) group, which contributes to its acidic properties. The fluorine substituents at the 2 and 4 positions enhance the compound's reactivity and influence its physical properties, such as solubility and boiling point. The hydroxyl group at the 3 position provides additional hydrogen bonding capabilities, which can affect its interactions in various chemical environments. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique combination of functional groups allows for diverse applications in research and industry, particularly in the development of fluorinated compounds. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₇H₄F₂O₃

InChI: InChI=1/C7H4F2O3/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,10H,(H,11,12)

SMILES: c1cc(c(c(c1C(=O)O)F)O)F

Synonyms:

• Benzoic Acid, 2,4-Difluoro-3-Hydroxy-
• 2,4-Difluoro-3-hydroxybenzoicacid

2,4-Difluoro-3-hydroxybenzoicacid

CAS: 91659-08-4

Formula: C₇H₄F₂O₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 174.1017

Ref: IN-DA00GULS

2,4-difluoro-3-hydroxybenzoic acid

CAS: 91659-08-4

2,4-difluoro-3-hydroxybenzoic acid

Purity: 95%

Molecular weight: 174.10g/mol

Ref: 54-PC901612

2,4-Difluoro-3-hydroxybenzoicacid

CAS: 91659-08-4

2,4-Difluoro-3-hydroxybenzoic acid is a benzene derivative that is used as a medicine. It can be prepared by methoxylation and deamination reactions. 2,4-Difluoro-3-hydroxybenzoic acid is an intermediate in the synthesis of other medicines.

Formula: C₇H₄F₂O₃

Purity: Min. 95%

Molecular weight: 174.1 g/mol

Ref: 3D-FD42965

2,4-Difluoro-3-hydroxybenzoic acid

CAS: 91659-08-4

Purity: 95%

Molecular weight: 174.1029968

Ref: 10-F606204