CAS 91659-19-7

Benzoic acid, 2-bromo-4-fluoro-5-hydroxy-

Description:

Benzoic acid, 2-bromo-4-fluoro-5-hydroxy- (CAS 91659-19-7) is an aromatic carboxylic acid characterized by the presence of a benzoic acid core with specific substituents that influence its chemical properties and reactivity. The compound features a bromine atom at the 2-position, a fluorine atom at the 4-position, and a hydroxyl group at the 5-position of the benzene ring. These substituents can affect the acidity of the carboxylic group, as well as the overall polarity and solubility of the compound in various solvents. The presence of the hydroxyl group also suggests potential for hydrogen bonding, which can enhance solubility in polar solvents. Additionally, the halogen substituents may impart unique reactivity, making the compound of interest in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Overall, the specific arrangement of functional groups in this compound contributes to its distinct chemical behavior and potential utility in research and industry.

Formula: C₇H₄BrFO₃

InChI: InChI=1S/C7H4BrFO3/c8-4-2-5(9)6(10)1-3(4)7(11)12/h1-2,10H,(H,11,12)

InChI key: InChIKey=NRRQMEMDKNSMOV-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Br)C=C(F)C(O)=C1

Synonyms:

• 2-Bromo-4-fluoro-5-hydroxybenzoic acid
• Benzoic acid, 2-bromo-4-fluoro-5-hydroxy-

2-Bromo-4-fluoro-5-hydroxybenzoic acid

CAS: 91659-19-7

2-Bromo-4-fluoro-5-hydroxybenzoic acid

Purity: 90%

Molecular weight: 235.01g/mol

Ref: 54-PC200314