CymitQuimica logo

CAS 916602-30-7

:

5-Hydroxy-6-(3-methyl-2-buten-1-yl)-2-(1E)-1-penten-1-yl-4-benzofurancarboxaldehyde

Description:
5-Hydroxy-6-(3-methyl-2-buten-1-yl)-2-(1E)-1-penten-1-yl-4-benzofurancarboxaldehyde, with the CAS number 916602-30-7, is a complex organic compound characterized by its unique structural features, including a benzofuran moiety and multiple functional groups such as hydroxyl and aldehyde. This compound is likely to exhibit properties typical of both aromatic and aliphatic compounds, including potential reactivity due to the presence of the aldehyde group, which can participate in various chemical reactions such as condensation and oxidation. The presence of the hydroxyl group suggests it may also engage in hydrogen bonding, influencing its solubility and boiling point. Additionally, the branched aliphatic chain contributes to its overall hydrophobic character. Such compounds may be of interest in fields like medicinal chemistry or materials science, where their unique structural attributes could lead to specific biological activities or applications in synthesis. However, detailed studies would be necessary to fully elucidate its properties, reactivity, and potential uses.
Formula:C19H22O3
InChI:InChI=1S/C19H22O3/c1-4-5-6-7-15-11-16-17(12-20)19(21)14(9-8-13(2)3)10-18(16)22-15/h6-8,10-12,21H,4-5,9H2,1-3H3/b7-6+
InChI key:InChIKey=SBYYFNVKZGJIPR-VOTSOKGWSA-N
SMILES:C(=O)C1=C2C(=CC(CC=C(C)C)=C1O)OC(/C=C/CCC)=C2
Synonyms:
  • 2-(2′,3-Epoxy-1′,3′-heptadienyl)-6-hydroxy-5-(3-methyl-2-butenyl)benzaldehyde
  • 4-Benzofurancarboxaldehyde, 5-hydroxy-6-(3-methyl-2-buten-1-yl)-2-(1E)-1-penten-1-yl-
  • 5-Hydroxy-6-(3-methyl-2-buten-1-yl)-2-(1E)-1-penten-1-yl-4-benzofurancarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.