CymitQuimica logo

CAS 916667-75-9

:

1-[[[dimethyl-(4-phenylphenyl)silyl]amino]-dimethyl-silyl]-4-phenyl-benzene

Description:
1-[[[Dimethyl-(4-phenylphenyl)silyl]amino]-dimethyl-silyl]-4-phenyl-benzene, identified by its CAS number 916667-75-9, is a silane compound characterized by the presence of silicon atoms bonded to organic groups. This compound features a complex structure that includes dimethylsilyl and phenyl groups, which contribute to its unique chemical properties. The presence of multiple phenyl rings suggests potential for π-π stacking interactions, which can influence its physical properties such as solubility and melting point. Additionally, the dimethylsilyl groups may impart hydrophobic characteristics, making the compound less soluble in polar solvents. The amino group in the structure indicates potential reactivity, allowing for further chemical modifications or interactions with other substances. Overall, this compound's characteristics, including its molecular structure and functional groups, suggest applications in materials science, particularly in the development of silane-based coatings or as intermediates in organic synthesis. However, specific properties such as boiling point, melting point, and reactivity would require empirical data for precise characterization.
Formula:C28H31NSi2
InChI:InChI=1/C28H31NSi2/c1-30(2,27-19-15-25(16-20-27)23-11-7-5-8-12-23)29-31(3,4)28-21-17-26(18-22-28)24-13-9-6-10-14-24/h5-22,29H,1-4H3
SMILES:C[Si](C)(c1ccc(cc1)c1ccccc1)N[Si](C)(C)c1ccc(cc1)c1ccccc1
Found 0 products.