CAS 916678-14-3

Carbonic acid, 2,2-difluoroethyl ethyl ester

Description:

Carbonic acid, 2,2-difluoroethyl ethyl ester, identified by CAS number 916678-14-3, is an organic compound characterized by the presence of a carbonic acid functional group esterified with a 2,2-difluoroethyl group and an ethyl group. This compound typically exhibits properties associated with esters, such as being a colorless liquid with a pleasant odor. The presence of fluorine atoms in the 2,2-difluoroethyl moiety can impart unique chemical properties, including increased lipophilicity and potential reactivity in various chemical processes. Carbonic acid esters are often used in organic synthesis and may serve as intermediates in the production of pharmaceuticals or agrochemicals. Additionally, the compound's stability and reactivity can be influenced by the surrounding functional groups and the overall molecular structure. Safety data should be consulted for handling and storage, as fluorinated compounds can exhibit specific environmental and health considerations.

Formula: C₅H₈F₂O₃

InChI: InChI=1S/C5H8F2O3/c1-2-9-5(8)10-3-4(6)7/h4H,2-3H2,1H3

InChI key: InChIKey=WXVCMUWGHFXASO-UHFFFAOYSA-N

SMILES: C(OCC(F)F)(OCC)=O

Synonyms:

• 2,2-Difluoroethyl ethyl carbonate
• Carbonic acid, 2,2-difluoroethyl ethyl ester

2,2-Difluoroethyl ethyl carbonate

CAS: 916678-14-3

2,2-Difluoroethyl ethyl carbonate

Formula: C₅H₈F₂O₃

Purity: ≥95%

Color and Shape: clear liquid

Molecular weight: 154.11g/mol

Ref: 54-PC48383

2,2-Difluoroethyl ethyl carbonate

CAS: 916678-14-3

2,2-Difluoroethyl ethyl carbonate is an electrolyte that belongs to the group of pyridinium salts. It is a colorless liquid with a layered structure and a melting point of -28°C. 2,2-Difluoroethyl ethyl carbonate has been used in Japan for the treatment of sectional bronchitis.

Formula: C₅H₈F₂O₃

Purity: Min. 95%

Molecular weight: 154.11 g/mol

Ref: 3D-RLB67814