CAS 916747-52-9

B-[2-Bromo-5-(1,1-dimethylethyl)phenyl]boronic acid

Description:

B-[2-Bromo-5-(1,1-dimethylethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a bromine atom and a bulky tert-butyl group attached to a phenyl ring, contributing to its steric properties and reactivity. The bromine substituent can participate in cross-coupling reactions, making this compound valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. The boronic acid moiety allows for further functionalization and is often utilized in Suzuki-Miyaura coupling reactions. Additionally, the compound's solubility and stability can be influenced by the presence of the bulky tert-butyl group, which may also affect its interactions in biological systems. Overall, B-[2-Bromo-5-(1,1-dimethylethyl)phenyl]boronic acid is a versatile reagent in synthetic organic chemistry, with applications in drug discovery and materials science.

Formula: C₁₀H₁₄BBrO₂

InChI: InChI=1S/C10H14BBrO2/c1-10(2,3)7-4-5-9(12)8(6-7)11(13)14/h4-6,13-14H,1-3H3

InChI key: InChIKey=VJXTZFJQNHGDIG-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC(C(C)(C)C)=CC=C1Br

Synonyms:

• Boronic acid, B-[2-bromo-5-(1,1-dimethylethyl)phenyl]-
• B-[2-Bromo-5-(1,1-dimethylethyl)phenyl]boronic acid
• (2-Bromo-5-tert-butylphenyl)boronic acid
• 2-Bromo-5-tert-butylphenylboronic acid

Boronic acid, B-[2-bromo-5-(1,1-dimethylethyl)phenyl]-

CAS: 916747-52-9

Formula: C₁₀H₁₄BBrO₂

Molecular weight: 256.9320

Ref: IN-DA01J0XA