CymitQuimica logo

CAS 916766-82-0

:

4-(1-methyl-1H-pyrazol-3-yl)aniline

Description:
4-(1-methyl-1H-pyrazol-3-yl)aniline, identified by its CAS number 916766-82-0, is an organic compound characterized by the presence of both an aniline and a pyrazole moiety. This compound features a pyrazole ring substituted at the 1-position with a methyl group and at the 3-position with an aniline group. It typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of both amine and heterocyclic functionalities. The aniline part contributes to its basicity, while the pyrazole ring can participate in various chemical reactions, including electrophilic substitutions. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and utility in synthesizing more complex molecules. Its structural characteristics suggest it could be involved in hydrogen bonding and π-π stacking interactions, which are relevant in biological systems and material applications.
Formula:C10H11N3
InChI:InChI=1/C10H11N3/c1-13-7-6-10(12-13)8-2-4-9(11)5-3-8/h2-7H,11H2,1H3
InChI key:WEFJHPBVOKVCLZ-UHFFFAOYSA-N
SMILES:Cn1ccc(c2ccc(cc2)N)n1
Found 5 products.