CAS 91678-23-8

2-Bromo-6-chloro-3-nitropyridine

Description:

2-Bromo-6-chloro-3-nitropyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound features three distinct substituents: a bromine atom at the 2-position, a chlorine atom at the 6-position, and a nitro group (-NO2) at the 3-position of the pyridine ring. These substituents contribute to its chemical reactivity and physical properties. The presence of halogens (bromine and chlorine) and a nitro group can enhance its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure makes it of interest in medicinal chemistry and materials science, where it may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated and nitro functionalities.

Formula: C₅H₂BrClN₂O₂

InChI: InChI=1/C5H2BrClN2O2/c6-5-3(9(10)11)1-2-4(7)8-5/h1-2H

SMILES: c1cc(Cl)nc(c1N(=O)=O)Br

Synonyms:

• Pyridine, 2-Bromo-6-Chloro-3-Nitro-

2-Bromo-6-chloro-3-nitropyridine

CAS: 91678-23-8

Formula: C₅H₂BrClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 237.4386

Ref: IN-DA00GUII

2-Bromo-6-chloro-3-nitropyridine

CAS: 91678-23-8

2-Bromo-6-chloro-3-nitropyridine

Purity: 98%

Molecular weight: 237.44g/mol

Ref: 54-OR314082

2-Bromo-6-chloro-3-nitropyridine

CAS: 91678-23-8

Formula: C₅H₂BrClN₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 237.44

Ref: 10-F077440