
CAS 916791-09-8
:1-(4-Chloro-2-pyrimidinyl)-3-piperidinol
Description:
1-(4-Chloro-2-pyrimidinyl)-3-piperidinol, identified by its CAS number 916791-09-8, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a pyrimidine moiety, which is a six-membered ring with two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the para position of the pyrimidine ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic heterocyclic compound and may exhibit properties such as solubility in polar solvents, depending on its functional groups. Its structural characteristics suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound's specific interactions, stability, and reactivity would depend on its environment and the presence of other functional groups or substituents. Overall, 1-(4-Chloro-2-pyrimidinyl)-3-piperidinol represents a class of compounds that may be of interest in drug discovery and development.
Formula:C9H12ClN3O
InChI:InChI=1S/C9H12ClN3O/c10-8-3-4-11-9(12-8)13-5-1-2-7(14)6-13/h3-4,7,14H,1-2,5-6H2
InChI key:InChIKey=LDDPUUZWMVKFQT-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC=C1)N2CC(O)CCC2
Synonyms:- 1-(4-Chloro-2-pyrimidinyl)-3-piperidinol
- 3-Piperidinol, 1-(4-chloro-2-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.