CAS 916791-16-7

4-Chloro-N-(4-piperidinylmethyl)-2-pyrimidinamine

Description:

4-Chloro-N-(4-piperidinylmethyl)-2-pyrimidinamine is a chemical compound characterized by its pyrimidine core, which is substituted with a chloro group and a piperidinylmethyl side chain. This structure suggests that it may exhibit properties typical of both pyrimidine derivatives and piperidine-containing compounds, potentially influencing its biological activity. The presence of the chloro substituent can enhance lipophilicity and affect the compound's interaction with biological targets. The piperidine moiety may contribute to its pharmacological profile, possibly enhancing binding affinity to certain receptors or enzymes. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential as a bioactive agent. Its specific applications and efficacy would depend on further studies, including in vitro and in vivo evaluations. As with many chemical substances, safety and handling precautions should be observed, given the potential for toxicity or reactivity associated with its functional groups.

Formula: C₁₀H₁₅ClN₄

InChI: InChI=1S/C10H15ClN4/c11-9-3-6-13-10(15-9)14-7-8-1-4-12-5-2-8/h3,6,8,12H,1-2,4-5,7H2,(H,13,14,15)

InChI key: InChIKey=FYBVWPKSBSFVAX-UHFFFAOYSA-N

SMILES: N(CC1CCNCC1)C=2N=C(Cl)C=CN2

Synonyms:

• 4-Chloro-N-(4-piperidinylmethyl)-2-pyrimidinamine
• 2-Pyrimidinamine, 4-chloro-N-(4-piperidinylmethyl)-