CymitQuimica logo

CAS 916791-21-4

:

4-(Chloromethyl)-N-1H-1,2,4-triazol-5-ylbenzamide

Description:
4-(Chloromethyl)-N-1H-1,2,4-triazol-5-ylbenzamide is a chemical compound characterized by its unique structural features, which include a benzamide moiety and a triazole ring. The presence of a chloromethyl group enhances its reactivity, making it a potential candidate for various chemical reactions and applications. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability under certain conditions and the ability to participate in hydrogen bonding due to the amide functional group. Its triazole ring contributes to its potential biological activity, as triazoles are known for their roles in pharmaceuticals, particularly as antifungal agents. The compound's solubility, melting point, and other physical properties can vary based on the solvent and environmental conditions. Overall, 4-(Chloromethyl)-N-1H-1,2,4-triazol-5-ylbenzamide is of interest in medicinal chemistry and materials science due to its structural diversity and potential applications.
Formula:C10H9ClN4O
InChI:InChI=1S/C10H9ClN4O/c11-5-7-1-3-8(4-2-7)9(16)14-10-12-6-13-15-10/h1-4,6H,5H2,(H2,12,13,14,15,16)
InChI key:InChIKey=HBGCXVOQOCZHLV-UHFFFAOYSA-N
SMILES:C(NC=1NC=NN1)(=O)C2=CC=C(CCl)C=C2
Synonyms:
  • 4-(Chloromethyl)-N-1H-1,2,4-triazol-5-ylbenzamide
  • Benzamide, 4-(chloromethyl)-N-1H-1,2,4-triazol-5-yl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.