CymitQuimica logo

CAS 916791-22-5

:

4-(Chloromethyl)-N-1H-pyrazol-4-ylbenzamide

Description:
4-(Chloromethyl)-N-1H-pyrazol-4-ylbenzamide is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a benzamide moiety. The presence of a chloromethyl group enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. This compound typically exhibits moderate to high solubility in polar organic solvents, which is common for compounds containing both aromatic and heterocyclic structures. Its molecular structure suggests potential biological activity, as many pyrazole derivatives are known for their pharmacological properties. The compound may also display specific melting and boiling points, which are essential for its characterization and application in synthesis. Additionally, it may undergo various chemical transformations, making it useful in medicinal chemistry and material science. Safety data should be consulted, as the chloromethyl group can pose hazards, necessitating appropriate handling and storage precautions. Overall, 4-(Chloromethyl)-N-1H-pyrazol-4-ylbenzamide represents a versatile compound with potential applications in research and industry.
Formula:C11H10ClN3O
InChI:InChI=1S/C11H10ClN3O/c12-5-8-1-3-9(4-2-8)11(16)15-10-6-13-14-7-10/h1-4,6-7H,5H2,(H,13,14)(H,15,16)
InChI key:InChIKey=AJZZOSSEFFZAMT-UHFFFAOYSA-N
SMILES:C(NC=1C=NNC1)(=O)C2=CC=C(CCl)C=C2
Synonyms:
  • Benzamide, 4-(chloromethyl)-N-1H-pyrazol-4-yl-
  • 4-(Chloromethyl)-N-1H-pyrazol-4-ylbenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.