
CAS 916791-29-2
:(3-Hydroxy-1-piperidinyl)-3-thienylmethanone
Description:
(3-Hydroxy-1-piperidinyl)-3-thienylmethanone, identified by its CAS number 916791-29-2, is a chemical compound that features a piperidine ring substituted with a hydroxyl group and a thienylmethanone moiety. This compound exhibits characteristics typical of both piperidine derivatives and thienyl compounds, which may include moderate solubility in polar solvents due to the presence of the hydroxyl group. The thienyl group contributes to its potential reactivity and biological activity, as thiophene derivatives are often involved in various pharmacological applications. The presence of the piperidine ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific stereochemical properties depending on the configuration of the piperidine and thienyl substituents, influencing its overall reactivity and biological interactions. Overall, this compound's unique structure positions it as a candidate for further research in drug development and synthetic chemistry.
Formula:C10H13NO2S
InChI:InChI=1S/C10H13NO2S/c12-9-2-1-4-11(6-9)10(13)8-3-5-14-7-8/h3,5,7,9,12H,1-2,4,6H2
InChI key:InChIKey=CUFFLLMLPBPXBZ-UHFFFAOYSA-N
SMILES:C(=O)(N1CC(O)CCC1)C=2C=CSC2
Synonyms:- (3-Hydroxy-1-piperidinyl)-3-thienylmethanone
- Methanone, (3-hydroxy-1-piperidinyl)-3-thienyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
