
CAS 916791-30-5
:[3-(Hydroxymethyl)-1-piperidinyl]-3-thienylmethanone
Description:
[3-(Hydroxymethyl)-1-piperidinyl]-3-thienylmethanone, identified by its CAS number 916791-30-5, is a chemical compound that features a piperidine ring substituted with a hydroxymethyl group and a thienylmethanone moiety. The presence of the hydroxymethyl group suggests potential for hydrogen bonding and increased solubility in polar solvents, while the thienyl group contributes to the compound's aromatic character and may influence its electronic properties. This compound may exhibit biological activity due to its structural features, which can interact with various biological targets. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's stability, reactivity, and solubility characteristics would depend on the specific functional groups and their arrangement, making it a subject of interest for further research in drug design and synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C11H15NO2S
InChI:InChI=1S/C11H15NO2S/c13-7-9-2-1-4-12(6-9)11(14)10-3-5-15-8-10/h3,5,8-9,13H,1-2,4,6-7H2
InChI key:InChIKey=ZOQNJFMZWPRUCS-UHFFFAOYSA-N
SMILES:C(=O)(N1CC(CO)CCC1)C=2C=CSC2
Synonyms:- Methanone, [3-(hydroxymethyl)-1-piperidinyl]-3-thienyl-
- [3-(Hydroxymethyl)-1-piperidinyl]-3-thienylmethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3-(Hydroxymethyl)piperidin-1-yl)(thiophen-3-yl)methanone
CAS:Formula:C11H15NO2SMolecular weight:225.3073
