CAS 916791-32-7

1-(3-Hydroxy-1-piperidinyl)-2-(3-thienyl)ethanone

Description:

1-(3-Hydroxy-1-piperidinyl)-2-(3-thienyl)ethanone, with the CAS number 916791-32-7, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a thienyl group, derived from thiophene, which contributes to its aromatic properties. The presence of a hydroxyl group (-OH) on the piperidine ring enhances its potential for hydrogen bonding, influencing its solubility and reactivity. The ethanone moiety indicates that it has a ketone functional group, which can participate in various chemical reactions, including nucleophilic additions. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique combination of functional groups and structural features makes it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₁H₁₅NO₂S

InChI: InChI=1S/C11H15NO2S/c13-10-2-1-4-12(7-10)11(14)6-9-3-5-15-8-9/h3,5,8,10,13H,1-2,4,6-7H2

InChI key: InChIKey=YUIAHIVECVNOAT-UHFFFAOYSA-N

SMILES: C(CC=1C=CSC1)(=O)N2CC(O)CCC2

Synonyms:

• Ethanone, 1-(3-hydroxy-1-piperidinyl)-2-(3-thienyl)-
• 1-(3-Hydroxy-1-piperidinyl)-2-(3-thienyl)ethanone