CymitQuimica logo

CAS 916791-33-8

:

1-[3-(Hydroxymethyl)-1-piperidinyl]-2-(3-thienyl)ethanone

Description:
1-[3-(Hydroxymethyl)-1-piperidinyl]-2-(3-thienyl)ethanone, with the CAS number 916791-33-8, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and a thienyl group, indicating the presence of a sulfur atom within a five-membered aromatic ring. The hydroxymethyl group attached to the piperidine enhances its solubility and reactivity, making it a versatile building block in organic synthesis. The ethanone moiety suggests that the compound possesses a ketone functional group, contributing to its potential reactivity in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups. Overall, this compound's unique structure positions it as a candidate for further research in both synthetic and pharmaceutical applications.
Formula:C12H17NO2S
InChI:InChI=1S/C12H17NO2S/c14-8-11-2-1-4-13(7-11)12(15)6-10-3-5-16-9-10/h3,5,9,11,14H,1-2,4,6-8H2
InChI key:InChIKey=VZJJEKUMRCWREZ-UHFFFAOYSA-N
SMILES:C(CC=1C=CSC1)(=O)N2CC(CO)CCC2
Synonyms:
  • 1-[3-(Hydroxymethyl)-1-piperidinyl]-2-(3-thienyl)ethanone
  • Ethanone, 1-[3-(hydroxymethyl)-1-piperidinyl]-2-(3-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.