
CAS 916791-34-9
:1,1-Dimethylethyl 3-[2-(methoxymethylamino)-2-oxoethyl]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 3-[2-(methoxymethylamino)-2-oxoethyl]-1-piperidinecarboxylate, identified by its CAS number 916791-34-9, is a chemical compound that features a piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group, contributing to its steric bulk, and a methoxymethylamino group that suggests potential for biological activity, possibly as a pharmacophore. The carboxylate functional group indicates that it may exhibit acidic properties, influencing its solubility and reactivity. The presence of the oxoethyl moiety suggests that it may participate in various chemical reactions, including nucleophilic attacks or condensation reactions. Overall, this compound's structure implies potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its complex functional groups and the ability to interact with biological targets. However, specific properties such as solubility, stability, and reactivity would need to be determined through experimental studies.
Formula:C14H26N2O4
InChI:InChI=1S/C14H26N2O4/c1-14(2,3)20-13(18)16-8-6-7-11(10-16)9-12(17)15(4)19-5/h11H,6-10H2,1-5H3
InChI key:InChIKey=BHDHOXGGLAEXCW-UHFFFAOYSA-N
SMILES:C(C(N(OC)C)=O)C1CN(C(OC(C)(C)C)=O)CCC1
Synonyms:- 1,1-Dimethylethyl 3-[2-(methoxymethylamino)-2-oxoethyl]-1-piperidinecarboxylate
- tert-Butyl 3-[2-[methoxy(methyl)amino]-2-oxoethyl]piperidine-1-carboxylate
- 1-Piperidinecarboxylic acid, 3-[2-(methoxymethylamino)-2-oxoethyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.