CymitQuimica logo

CAS 916791-64-5

:

5-Chloro-1,3-benzoxazol-6-amine

Description:
5-Chloro-1,3-benzoxazol-6-amine is an organic compound characterized by its benzoxazole core, which consists of a fused benzene and oxazole ring. The presence of a chlorine atom at the 5-position and an amino group at the 6-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. It may also display biological activity, making it of interest in pharmaceutical research. The chlorine substituent can influence its reactivity and stability, potentially participating in electrophilic substitution reactions. Additionally, the compound's structure suggests it may have applications in materials science or as an intermediate in organic synthesis. As with many nitrogen-containing heterocycles, it may also exhibit fluorescence or other electronic properties, depending on its environment. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C7H5ClN2O
InChI:InChI=1/C7H5ClN2O/c8-4-1-6-7(2-5(4)9)11-3-10-6/h1-3H,9H2
SMILES:c1c(c(cc2c1nco2)N)Cl
Synonyms:
  • 6-Benzoxazolamine, 5-Chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.