CAS 916792-08-0
:2,3,5,6-Tetrafluoro-4-pyridinepropanoic acid
Description:
2,3,5,6-Tetrafluoro-4-pyridinepropanoic acid is a fluorinated organic compound characterized by its pyridine ring and a propanoic acid functional group. The presence of four fluorine atoms significantly influences its chemical properties, enhancing its polarity and potentially increasing its reactivity compared to non-fluorinated analogs. This compound is likely to exhibit strong hydrogen bonding capabilities due to the carboxylic acid group, which can also affect its solubility in various solvents. The fluorine substituents can impart unique electronic properties, making it of interest in medicinal chemistry and materials science. Additionally, the compound may exhibit distinct thermal and chemical stability due to the strong C-F bonds. Its applications could range from pharmaceuticals to agrochemicals, where fluorinated compounds are often utilized for their enhanced biological activity and stability. Overall, 2,3,5,6-Tetrafluoro-4-pyridinepropanoic acid represents a versatile structure with potential utility in various chemical and industrial applications.
Formula:C8H5F4NO2
InChI:InChI=1S/C8H5F4NO2/c9-5-3(1-2-4(14)15)6(10)8(12)13-7(5)11/h1-2H2,(H,14,15)
InChI key:InChIKey=JMKYZXITFXJYBO-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C=1C(F)=C(F)N=C(F)C1F
Synonyms:- 2,3,5,6-Tetrafluoro-4-pyridinepropanoic acid
- 3-(2,3,5,6-Tetrafluoro-4-Pyridyl)Propanoic Acid
- 4-Pyridinepropanoic acid, 2,3,5,6-tetrafluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
