CAS 916792-13-7

4-Bromo-2-fluoro-5-methylbenzonitrile

Description:

4-Bromo-2-fluoro-5-methylbenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom, a fluorine atom, a methyl group, and a nitrile group. The presence of the bromine and fluorine substituents contributes to its unique reactivity and potential applications in various chemical reactions, particularly in the synthesis of pharmaceuticals and agrochemicals. The nitrile group (-C≡N) is known for its ability to participate in nucleophilic addition reactions and can serve as a versatile functional group in organic synthesis. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests that it may have interesting electronic properties due to the electron-withdrawing effects of the bromine and fluorine atoms, which can influence its reactivity and interactions with other molecules. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks.

Formula: C₈H₅BrFN

InChI: InChI=1S/C8H5BrFN/c1-5-2-6(4-11)8(10)3-7(5)9/h2-3H,1H3

InChI key: InChIKey=AVBKISZUVMWQIA-UHFFFAOYSA-N

SMILES: C(#N)C1=C(F)C=C(Br)C(C)=C1

Synonyms:

• 4-Bromo-2-fluoro-5-methylbenzonitrile
• Benzonitrile, 4-Bromo-2-Fluoro-5-Methyl-

4-Bromo-2-Fluoro-5-Methylbenzonitrile

CAS: 916792-13-7

Formula: C₈H₅BrFN

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.0344

Ref: IN-DA00GUN5

4-Bromo-2-fluoro-5-methylbenzonitrile

CAS: 916792-13-7

4-Bromo-2-fluoro-5-methylbenzonitrile

Purity: 99%

Molecular weight: 214.03g/mol

Ref: 54-PC520560

4-Bromo-2-fluoro-5-methylbenzonitrile

CAS: 916792-13-7

Formula: C₈H₅BrFN

Purity: 98%

Color and Shape: Solid

Molecular weight: 214.037

Ref: 10-F069437