CymitQuimica logo

CAS 916812-09-4

:

6-Quinolinecarboxylic acid, 8-chloro-, ethyl ester

Description:
6-Quinolinecarboxylic acid, 8-chloro-, ethyl ester is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a carboxylic acid functional group at the 6-position and an ethyl ester group, with a chlorine substituent at the 8-position. The presence of the chlorine atom introduces unique reactivity and influences the compound's physical properties, such as solubility and boiling point. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic character, which can affect their biological activity and potential applications in pharmaceuticals or agrochemicals. The ethyl ester moiety can enhance the compound's permeability and bioavailability. Additionally, the quinoline framework is known for its diverse biological activities, including antimicrobial and antitumor properties. Overall, 6-Quinolinecarboxylic acid, 8-chloro-, ethyl ester represents a significant structure in medicinal chemistry, warranting further investigation for its potential therapeutic applications.
Formula:C12H10ClNO2
InChI:InChI=1S/C12H10ClNO2/c1-2-16-12(15)9-6-8-4-3-5-14-11(8)10(13)7-9/h3-7H,2H2,1H3
InChI key:InChIKey=FYMPYWUKGBBZFM-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(C(OCC)=O)C1)C=CC=N2
Synonyms:
  • 6-Quinolinecarboxylic acid, 8-chloro-, ethyl ester
  • Ethyl 8-chloro-6-quinolinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.