CymitQuimica logo

CAS 916812-10-7

:

8-Chloro-6-quinolinemethanol

Description:
8-Chloro-6-quinolinemethanol is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group at the 8-position and a hydroxymethyl group at the 6-position of the quinoline ring. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the chloro substituent can influence its reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The hydroxymethyl group can participate in hydrogen bonding, potentially affecting the compound's interactions with biological targets. Additionally, 8-Chloro-6-quinolinemethanol may exhibit antimicrobial or antitumor properties, which are common among quinoline derivatives. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound represents a unique structure that may have applications in various fields, including pharmaceuticals and materials science.
Formula:C10H8ClNO
InChI:InChI=1S/C10H8ClNO/c11-9-5-7(6-13)4-8-2-1-3-12-10(8)9/h1-5,13H,6H2
InChI key:InChIKey=RZJJJVCIYFDGJA-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(CO)C1)C=CC=N2
Synonyms:
  • (8-Chloro-6-quinolinyl)methanol
  • 8-Chloro-6-quinolinemethanol
  • 6-Quinolinemethanol, 8-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.