CAS 916813-19-9

N-(3-amino-4-chlorophenyl)-2-methylpropanamide

Description:

N-(3-amino-4-chlorophenyl)-2-methylpropanamide, with the CAS number 916813-19-9, is a chemical compound characterized by its amide functional group, which is derived from the reaction of an amine and a carboxylic acid. This compound features a 2-methylpropanamide backbone, indicating the presence of a branched alkyl group, which can influence its solubility and reactivity. The presence of a 3-amino-4-chlorophenyl group suggests that it has potential biological activity, as aromatic amines are often involved in various biochemical interactions. The chlorine substituent on the phenyl ring can affect the compound's electronic properties and steric hindrance, potentially impacting its pharmacological profile. This compound may exhibit polar characteristics due to the amide group, which can enhance its solubility in polar solvents. Overall, N-(3-amino-4-chlorophenyl)-2-methylpropanamide is of interest in medicinal chemistry and may be studied for its potential therapeutic applications.

Formula: C₁₀H₁₃ClN₂O

InChI: InChI=1/C10H13ClN2O/c1-6(2)10(14)13-7-3-4-8(11)9(12)5-7/h3-6H,12H2,1-2H3,(H,13,14)

SMILES: CC(C)C(=Nc1ccc(c(c1)N)Cl)O