CAS 91682-95-0
:cepacin A
Description:
Cepacin A is a natural compound classified as a secondary metabolite, primarily derived from certain species of fungi, particularly those in the genus Penicillium. It exhibits a complex chemical structure characterized by a bicyclic system, which contributes to its biological activity. Cepacin A is known for its antimicrobial properties, making it of interest in the field of pharmaceuticals and agriculture. The compound has shown potential in inhibiting the growth of various pathogenic microorganisms, including bacteria and fungi. Additionally, cepacin A may possess cytotoxic effects against certain cancer cell lines, highlighting its potential as an anticancer agent. Its mechanism of action often involves disrupting cellular processes in target organisms. As a chemical entity, cepacin A is typically studied for its structural features, biological activities, and potential applications in drug development. However, further research is necessary to fully understand its mechanisms and optimize its use in therapeutic contexts.
Formula:C16H14O4
InChI:InChI=1/C16H14O4/c1-2-3-4-5-6-7-8-14(17)15(18)11-9-13-10-12-16(19)20-13/h1,5,7,9,11,13,15,18H,8,10,12H2/b11-9+
Synonyms:- cepacin A
- 5-[3-[3-(1,2-Heptadiene-4,6-diynyl)oxiranyl]-3-hydroxy-1-propenyl]-3,4-dihydro-2(5H)-furanone
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cepacin A
CAS:Cepacin A is an alkyne antibiotic with antibacterial properties, exhibiting a minimum inhibitory concentration (MIC) of 0.2 μg/mL against Staphylococcus. Additionally, Cepacin A displays a degree of toxicity in mice, with an LD50 of 30 mg/kg when administered intraperitoneally.Formula:C16H14O4Color and Shape:SolidMolecular weight:270.28
